C18H13ClN2O2S2 — CID 1097001
N-[(4-acetylphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 1097001) has the molecular formula C18H13ClN2O2S2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[(4-acetylphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(4-acetylphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1097001 |
| Molecular Formula | C18H13ClN2O2S2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | N-[(4-acetylphenyl)carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=S)NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O2S2/c1-10(22)11-6-8-12(9-7-11)20-18(24)21-17(23)16-15(19)13-4-2-3-5-14(13)25-16/h2-9H,1H3,(H2,20,21,23,24) |
| InChIKey | BPFCVNUALYNLQO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|