C24H20ClNO3S — CID 160752095
3-chloro-N-[4-(4-methoxybenzoyl)phenyl]-1-benzothiophene-2-carboxamide;methane (PubChem CID 160752095) has the molecular formula C24H20ClNO3S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-chloro-N-[4-(4-methoxybenzoyl)phenyl]-1-benzothiophene-2-carboxamide;methane.
| Compound Name | 3-chloro-N-[4-(4-methoxybenzoyl)phenyl]-1-benzothiophene-2-carboxamide;methane |
|---|---|
| PubChem CID | 160752095 |
| Molecular Formula | C24H20ClNO3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-chloro-N-[4-(4-methoxybenzoyl)phenyl]-1-benzothiophene-2-carboxamide;methane |
| SMILES | C.COc1ccc(C(=O)c2ccc(NC(=O)c3sc4ccccc4c3Cl)cc2)cc1 |
| InChI | InChI=1S/C23H16ClNO3S.CH4/c1-28-17-12-8-15(9-13-17)21(26)14-6-10-16(11-7-14)25-23(27)22-20(24)18-4-2-3-5-19(18)29-22;/h2-13H,1H3,(H,25,27);1H4 |
| InChIKey | RWYQOCMMPNYGMT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |