C22H14ClNO3S — CID 19225549
[4-(phenylcarbamoyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19225549) has the molecular formula C22H14ClNO3S and a molecular weight of 407.88 g/mol. Its IUPAC name is [4-(phenylcarbamoyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-(phenylcarbamoyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19225549 |
| Molecular Formula | C22H14ClNO3S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | [4-(phenylcarbamoyl)phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(Nc1ccccc1)c1ccc(OC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C22H14ClNO3S/c23-19-17-8-4-5-9-18(17)28-20(19)22(26)27-16-12-10-14(11-13-16)21(25)24-15-6-2-1-3-7-15/h1-13H,(H,24,25) |
| InChIKey | UDVYWDDASDLZAD-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|