C23H15ClN2O3S — CID 4522801
[2-[(benzoylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 4522801) has the molecular formula C23H15ClN2O3S and a molecular weight of 434.90 g/mol. Its IUPAC name is [2-[(benzoylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(benzoylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4522801 |
| Molecular Formula | C23H15ClN2O3S |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | [2-[(benzoylhydrazinylidene)methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1ccccc1OC(=O)c1sc2ccccc2c1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H15ClN2O3S/c24-20-17-11-5-7-13-19(17)30-21(20)23(28)29-18-12-6-4-10-16(18)14-25-26-22(27)15-8-2-1-3-9-15/h1-14H,(H,26,27) |
| InChIKey | XHFBJNCLECFYAI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|