C24H14Cl3N3O4S — CID 5014203
[2-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 5014203) has the molecular formula C24H14Cl3N3O4S and a molecular weight of 546.82 g/mol. Its IUPAC name is [2-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 5014203 |
| Molecular Formula | C24H14Cl3N3O4S |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 544.98 |
| IUPAC Name | [2-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1ccccc1OC(=O)c1sc2ccccc2c1Cl)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H14Cl3N3O4S/c25-16-10-9-14(11-17(16)26)29-22(31)23(32)30-28-12-13-5-1-3-7-18(13)34-24(33)21-20(27)15-6-2-4-8-19(15)35-21/h1-12H,(H,29,31)(H,30,32) |
| InChIKey | GEMDDVYCKKPJJP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|