C25H16Cl3N3O5S — CID 3798331
[4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 3798331) has the molecular formula C25H16Cl3N3O5S and a molecular weight of 576.85 g/mol. Its IUPAC name is [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3798331 |
| Molecular Formula | C25H16Cl3N3O5S |
| Molecular Weight | 576.85 g/mol |
| Exact Mass | 574.99 |
| IUPAC Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H16Cl3N3O5S/c1-35-19-10-13(12-29-31-24(33)23(32)30-14-7-8-16(26)17(27)11-14)6-9-18(19)36-25(34)22-21(28)15-4-2-3-5-20(15)37-22/h2-12H,1H3,(H,30,32)(H,31,33) |
| InChIKey | ISYILHUSUBPGRS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|