C26H19BrClN3O5S — CID 6043041
[4-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6043041) has the molecular formula C26H19BrClN3O5S and a molecular weight of 600.88 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6043041 |
| Molecular Formula | C26H19BrClN3O5S |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | [4-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1cc(/C=N\NC(=O)CNC(=O)c2cccc(Br)c2)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H19BrClN3O5S/c1-35-20-11-15(13-30-31-22(32)14-29-25(33)16-5-4-6-17(27)12-16)9-10-19(20)36-26(34)24-23(28)18-7-2-3-8-21(18)37-24/h2-13H,14H2,1H3,(H,29,33)(H,31,32)/b30-13- |
| InChIKey | FATIBYCDAITHHO-YNFMAFFXSA-N |
| XLogP | 5.43 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|