C24H17BrClNO3S — CID 94831912
[4-[(3-bromophenyl)iminomethyl]-2-ethoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 94831912) has the molecular formula C24H17BrClNO3S and a molecular weight of 514.83 g/mol. Its IUPAC name is [4-[(3-bromophenyl)iminomethyl]-2-ethoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(3-bromophenyl)iminomethyl]-2-ethoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 94831912 |
| Molecular Formula | C24H17BrClNO3S |
| Molecular Weight | 514.83 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | [4-[(3-bromophenyl)iminomethyl]-2-ethoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCOc1cc(/C=N/c2cccc(Br)c2)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C24H17BrClNO3S/c1-2-29-20-12-15(14-27-17-7-5-6-16(25)13-17)10-11-19(20)30-24(28)23-22(26)18-8-3-4-9-21(18)31-23/h3-14H,2H2,1H3/b27-14+ |
| InChIKey | FKIWLLHKXBWKME-MZJWZYIUSA-N |
| XLogP | 7.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.83 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|