C26H20ClNO5S — CID 94831914
[2-ethoxy-4-[(2-methoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 94831914) has the molecular formula C26H20ClNO5S and a molecular weight of 493.97 g/mol. Its IUPAC name is [2-ethoxy-4-[(2-methoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[(2-methoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 94831914 |
| Molecular Formula | C26H20ClNO5S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [2-ethoxy-4-[(2-methoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCOc1cc(/C=N/c2ccccc2C(=O)OC)ccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H20ClNO5S/c1-3-32-21-14-16(15-28-19-10-6-4-8-17(19)25(29)31-2)12-13-20(21)33-26(30)24-23(27)18-9-5-7-11-22(18)34-24/h4-15H,3H2,1-2H3/b28-15+ |
| InChIKey | QBOWYWZMRPMLNY-RWPZCVJISA-N |
| XLogP | 6.71 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|