C29H27ClN2O5S — CID 6181397
[4-[(Z)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6181397) has the molecular formula C29H27ClN2O5S and a molecular weight of 551.06 g/mol. Its IUPAC name is [4-[(Z)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[(Z)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6181397 |
| Molecular Formula | C29H27ClN2O5S |
| Molecular Weight | 551.06 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | [4-[(Z)-[[2-(4-butylphenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCCCc1ccc(OCC(=O)N/N=C\c2ccc(OC(=O)c3sc4ccccc4c3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H27ClN2O5S/c1-3-4-7-19-10-13-21(14-11-19)36-18-26(33)32-31-17-20-12-15-23(24(16-20)35-2)37-29(34)28-27(30)22-8-5-6-9-25(22)38-28/h5-6,8-17H,3-4,7,18H2,1-2H3,(H,32,33)/b31-17- |
| InChIKey | WWGOYQFIOWSLMQ-LJUMEUDFSA-N |
| XLogP | 6.65 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.06 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|