C27H22ClN3O5S — CID 3579073
[4-[[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 3579073) has the molecular formula C27H22ClN3O5S and a molecular weight of 536.01 g/mol. Its IUPAC name is [4-[[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 3579073 |
| Molecular Formula | C27H22ClN3O5S |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | [4-[[[2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(C=NNC(=O)CNC(=O)c2sc3ccccc3c2Cl)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H22ClN3O5S/c1-16-7-10-18(11-8-16)27(34)36-20-12-9-17(13-21(20)35-2)14-30-31-23(32)15-29-26(33)25-24(28)19-5-3-4-6-22(19)37-25/h3-14H,15H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | TXOXREMCIVTSPM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|