C21H20ClN3O5S — CID 3478183
3-chloro-N-[2-oxo-2-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 3478183) has the molecular formula C21H20ClN3O5S and a molecular weight of 461.93 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-oxo-2-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3478183 |
| Molecular Formula | C21H20ClN3O5S |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-[2-[(2,4,5-trimethoxyphenyl)methylidene]hydrazinyl]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1C=NNC(=O)CNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H20ClN3O5S/c1-28-14-9-16(30-3)15(29-2)8-12(14)10-24-25-18(26)11-23-21(27)20-19(22)13-6-4-5-7-17(13)31-20/h4-10H,11H2,1-3H3,(H,23,27)(H,25,26) |
| InChIKey | GYMAQAMKHSSOGX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|