C18H12Cl3N3O2S — CID 4535802
3-chloro-N-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 4535802) has the molecular formula C18H12Cl3N3O2S and a molecular weight of 440.74 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4535802 |
| Molecular Formula | C18H12Cl3N3O2S |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 3-chloro-N-[2-[2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)NN=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H12Cl3N3O2S/c19-12-5-3-6-13(20)11(12)8-23-24-15(25)9-22-18(26)17-16(21)10-4-1-2-7-14(10)27-17/h1-8H,9H2,(H,22,26)(H,24,25) |
| InChIKey | VOQSCBBGTBKKAJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|