C27H20ClN5O2S — CID 4253445
3-chloro-N-[2-[2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 4253445) has the molecular formula C27H20ClN5O2S and a molecular weight of 514.01 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4253445 |
| Molecular Formula | C27H20ClN5O2S |
| Molecular Weight | 514.01 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 3-chloro-N-[2-[2-[(1,3-diphenylpyrazol-4-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)NN=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H20ClN5O2S/c28-24-21-13-7-8-14-22(21)36-26(24)27(35)29-16-23(34)31-30-15-19-17-33(20-11-5-2-6-12-20)32-25(19)18-9-3-1-4-10-18/h1-15,17H,16H2,(H,29,35)(H,31,34) |
| InChIKey | DPIWBBJVRHRZOO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|