C28H22ClN5O2S — CID 6106404
3-chloro-N-[2-[(2Z)-2-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 6106404) has the molecular formula C28H22ClN5O2S and a molecular weight of 528.04 g/mol. Its IUPAC name is 3-chloro-N-[2-[(2Z)-2-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[(2Z)-2-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 6106404 |
| Molecular Formula | C28H22ClN5O2S |
| Molecular Weight | 528.04 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 3-chloro-N-[2-[(2Z)-2-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)CNC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C28H22ClN5O2S/c1-18-11-13-19(14-12-18)26-20(17-34(33-26)21-7-3-2-4-8-21)15-31-32-24(35)16-30-28(36)27-25(29)22-9-5-6-10-23(22)37-27/h2-15,17H,16H2,1H3,(H,30,36)(H,32,35)/b31-15- |
| InChIKey | JLEHSTVZBNHSKD-BVMLUPFRSA-N |
| XLogP | 5.60 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|