C23H26N5O+ — CID 7270875
N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 7270875) has the molecular formula C23H26N5O+ and a molecular weight of 388.50 g/mol. Its IUPAC name is N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 7270875 |
| Molecular Formula | C23H26N5O+ |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C23H25N5O/c1-18-9-11-19(12-10-18)23-20(16-28(26-23)21-7-3-2-4-8-21)15-24-25-22(29)17-27-13-5-6-14-27/h2-4,7-12,15-16H,5-6,13-14,17H2,1H3,(H,25,29)/p+1/b24-15- |
| InChIKey | WYHSQVQMBHWSJK-IWIPYMOSSA-O |
| XLogP | 1.98 |
| TPSA | 63.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|