C30H26N4O7 — CID 139220582
[4,5-diacetyloxy-2-[[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]carbamoyl]phenyl] acetate (PubChem CID 139220582) has the molecular formula C30H26N4O7 and a molecular weight of 554.56 g/mol. Its IUPAC name is [4,5-diacetyloxy-2-[[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]carbamoyl]phenyl] acetate.
| Compound Name | [4,5-diacetyloxy-2-[[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 139220582 |
| Molecular Formula | C30H26N4O7 |
| Molecular Weight | 554.56 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [4,5-diacetyloxy-2-[[(Z)-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(OC(C)=O)c(C(=O)N/N=C\c2cn(-c3ccccc3)nc2-c2ccc(C)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C30H26N4O7/c1-18-10-12-22(13-11-18)29-23(17-34(33-29)24-8-6-5-7-9-24)16-31-32-30(38)25-14-27(40-20(3)36)28(41-21(4)37)15-26(25)39-19(2)35/h5-17H,1-4H3,(H,32,38)/b31-16- |
| InChIKey | ODSCBLNYYUJXCH-ACXHZZMFSA-N |
| XLogP | 4.39 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|