C21H18N6O2S — CID 6075112
N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylthiadiazole-5-carboxamide (PubChem CID 6075112) has the molecular formula C21H18N6O2S and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 6075112 |
| Molecular Formula | C21H18N6O2S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylthiadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2snnc2C)cc1 |
| InChI | InChI=1S/C21H18N6O2S/c1-14-20(30-26-23-14)21(28)24-22-12-16-13-27(17-6-4-3-5-7-17)25-19(16)15-8-10-18(29-2)11-9-15/h3-13H,1-2H3,(H,24,28)/b22-12+ |
| InChIKey | DGVIZPACNYFJDG-WSDLNYQXSA-N |
| XLogP | 3.47 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|