C25H22N4O2 — CID 9231607
4-methoxy-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 9231607) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-methoxy-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9231607 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-methoxy-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cn(-c3ccccc3C)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N4O2/c1-18-8-6-7-11-23(18)29-17-21(24(28-29)19-9-4-3-5-10-19)16-26-27-25(30)20-12-14-22(31-2)15-13-20/h3-17H,1-2H3,(H,27,30)/b26-16- |
| InChIKey | RHRDAXRURKHKFJ-QQXSKIMKSA-N |
| XLogP | 4.62 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|