C22H19N5O — CID 9027170
N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 9027170) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9027170 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccccc1-n1cc(/C=N\NC(=O)c2ccc[nH]2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H19N5O/c1-16-8-5-6-12-20(16)27-15-18(21(26-27)17-9-3-2-4-10-17)14-24-25-22(28)19-11-7-13-23-19/h2-15,23H,1H3,(H,25,28)/b24-14- |
| InChIKey | HRIVUEVWIGLBIU-OYKKKHCWSA-N |
| XLogP | 3.94 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|