C24H19FN4O — CID 9214901
2-fluoro-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide (PubChem CID 9214901) has the molecular formula C24H19FN4O and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-fluoro-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 2-fluoro-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 9214901 |
| Molecular Formula | C24H19FN4O |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-fluoro-N-[(Z)-[1-(2-methylphenyl)-3-phenylpyrazol-4-yl]methylideneamino]benzamide |
| SMILES | Cc1ccccc1-n1cc(/C=N\NC(=O)c2ccccc2F)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H19FN4O/c1-17-9-5-8-14-22(17)29-16-19(23(28-29)18-10-3-2-4-11-18)15-26-27-24(30)20-12-6-7-13-21(20)25/h2-16H,1H3,(H,27,30)/b26-15- |
| InChIKey | OXFRMNUTVUINGD-YSMPRRRNSA-N |
| XLogP | 4.75 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|