C21H15BrN4OS — CID 2354736
2-bromo-N-[(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide (PubChem CID 2354736) has the molecular formula C21H15BrN4OS and a molecular weight of 451.35 g/mol. Its IUPAC name is 2-bromo-N-[(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2354736 |
| Molecular Formula | C21H15BrN4OS |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 2-bromo-N-[(3-phenyl-1-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cn(-c2cccs2)nc1-c1ccccc1)c1ccccc1Br |
| InChI | InChI=1S/C21H15BrN4OS/c22-18-10-5-4-9-17(18)21(27)24-23-13-16-14-26(19-11-6-12-28-19)25-20(16)15-7-2-1-3-8-15/h1-14H,(H,24,27) |
| InChIKey | RFLPYUZJKWECKD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|