C21H17N5OS — CID 21370941
2-amino-N-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide (PubChem CID 21370941) has the molecular formula C21H17N5OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-amino-N-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 21370941 |
| Molecular Formula | C21H17N5OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-amino-N-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]benzamide |
| SMILES | Nc1ccccc1C(=O)N/N=C/c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C21H17N5OS/c22-18-10-5-4-9-17(18)21(27)24-23-13-15-14-26(16-7-2-1-3-8-16)25-20(15)19-11-6-12-28-19/h1-14H,22H2,(H,24,27)/b23-13+ |
| InChIKey | TYVIIXRKRNGPAI-YDZHTSKRSA-N |
| XLogP | 3.95 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|