C21H17N5OS — CID 56727062
1-phenyl-3-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]urea (PubChem CID 56727062) has the molecular formula C21H17N5OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-phenyl-3-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]urea.
| Compound Name | 1-phenyl-3-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 56727062 |
| Molecular Formula | C21H17N5OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 1-phenyl-3-[(E)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1cn(-c2ccccc2)nc1-c1cccs1)Nc1ccccc1 |
| InChI | InChI=1S/C21H17N5OS/c27-21(23-17-8-3-1-4-9-17)24-22-14-16-15-26(18-10-5-2-6-11-18)25-20(16)19-12-7-13-28-19/h1-15H,(H2,23,24,27)/b22-14+ |
| InChIKey | AFXWGLANZOLTKA-HYARGMPZSA-N |
| XLogP | 4.76 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|