C18H12N6OS — CID 71952798
5-[2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 71952798) has the molecular formula C18H12N6OS and a molecular weight of 360.40 g/mol. Its IUPAC name is 5-[2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 71952798 |
| Molecular Formula | C18H12N6OS |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-[2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1ncoc1NN=Cc1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C18H12N6OS/c19-9-15-18(25-12-20-15)22-21-10-13-11-24(14-5-2-1-3-6-14)23-17(13)16-7-4-8-26-16/h1-8,10-12,22H |
| InChIKey | DOEBCKOPFBKWHV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|