C21H15N4O2S- — CID 7417340
3-[(2Z)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]benzoate (PubChem CID 7417340) has the molecular formula C21H15N4O2S- and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(2Z)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 3-[(2Z)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7417340 |
| Molecular Formula | C21H15N4O2S- |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[(2Z)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylidene]hydrazinyl]benzoate |
| SMILES | O=C([O-])c1cccc(N/N=C\c2cn(-c3ccccc3)nc2-c2cccs2)c1 |
| InChI | InChI=1S/C21H16N4O2S/c26-21(27)15-6-4-7-17(12-15)23-22-13-16-14-25(18-8-2-1-3-9-18)24-20(16)19-10-5-11-28-19/h1-14,23H,(H,26,27)/p-1/b22-13- |
| InChIKey | PESAKLYUWLBBTB-XKZIYDEJSA-M |
| XLogP | 3.41 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|