C20H13Cl3N4S — CID 4555305
2,4,6-trichloro-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]aniline (PubChem CID 4555305) has the molecular formula C20H13Cl3N4S and a molecular weight of 447.78 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 4555305 |
| Molecular Formula | C20H13Cl3N4S |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 445.99 |
| IUPAC Name | 2,4,6-trichloro-N-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]aniline |
| SMILES | Clc1cc(Cl)c(NN=Cc2cn(-c3ccccc3)nc2-c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C20H13Cl3N4S/c21-14-9-16(22)20(17(23)10-14)25-24-11-13-12-27(15-5-2-1-3-6-15)26-19(13)18-7-4-8-28-18/h1-12,25H |
| InChIKey | VSEBRXJVBMJVDM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|