C21H14BrCl2N5 — CID 71844798
4-bromo-2,6-dichloro-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline (PubChem CID 71844798) has the molecular formula C21H14BrCl2N5 and a molecular weight of 487.19 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 71844798 |
| Molecular Formula | C21H14BrCl2N5 |
| Molecular Weight | 487.19 g/mol |
| Exact Mass | 484.98 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NN=Cc1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C21H14BrCl2N5/c22-16-10-18(23)21(19(24)11-16)27-26-12-15-13-29(17-4-2-1-3-5-17)28-20(15)14-6-8-25-9-7-14/h1-13,27H |
| InChIKey | ZANJGCOQRVEYNU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.19 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|