C22H16ClN5O — CID 9015279
N-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 9015279) has the molecular formula C22H16ClN5O and a molecular weight of 401.86 g/mol. Its IUPAC name is N-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 9015279 |
| Molecular Formula | C22H16ClN5O |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1cccc(Cl)c1)c1ccncc1 |
| InChI | InChI=1S/C22H16ClN5O/c23-19-6-4-5-17(13-19)21-18(15-28(27-21)20-7-2-1-3-8-20)14-25-26-22(29)16-9-11-24-12-10-16/h1-15H,(H,26,29)/b25-14- |
| InChIKey | UKRSGVNEGREROF-QFEZKATASA-N |
| XLogP | 4.35 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|