C21H16N6O — CID 6899097
N-[(E)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 6899097) has the molecular formula C21H16N6O and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[(E)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(E)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6899097 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(E)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C/c1cn(-c2ccccc2)nc1-c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C21H16N6O/c28-21(17-7-5-11-23-13-17)25-24-14-18-15-27(19-8-2-1-3-9-19)26-20(18)16-6-4-10-22-12-16/h1-15H,(H,25,28)/b24-14+ |
| InChIKey | TYHBLDCWBBNDKJ-ZVHZXABRSA-N |
| XLogP | 3.09 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|