C26H23N7O — CID 6087292
1-ethyl-2-methyl-N-[(Z)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzimidazole-5-carboxamide (PubChem CID 6087292) has the molecular formula C26H23N7O and a molecular weight of 449.52 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[(Z)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzimidazole-5-carboxamide.
| Compound Name | 1-ethyl-2-methyl-N-[(Z)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 6087292 |
| Molecular Formula | C26H23N7O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-ethyl-2-methyl-N-[(Z)-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylideneamino]benzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)N/N=C\c3cn(-c4ccccc4)nc3-c3cccnc3)ccc21 |
| InChI | InChI=1S/C26H23N7O/c1-3-32-18(2)29-23-14-19(11-12-24(23)32)26(34)30-28-16-21-17-33(22-9-5-4-6-10-22)31-25(21)20-8-7-13-27-15-20/h4-17H,3H2,1-2H3,(H,30,34)/b28-16- |
| InChIKey | YMMDKWBIPIEMQC-NTFVMDSBSA-N |
| XLogP | 4.38 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|