C18H13F5N4O — CID 4680774
1-ethyl-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzimidazole-5-carboxamide (PubChem CID 4680774) has the molecular formula C18H13F5N4O and a molecular weight of 396.32 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzimidazole-5-carboxamide.
| Compound Name | 1-ethyl-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 4680774 |
| Molecular Formula | C18H13F5N4O |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-ethyl-2-methyl-N-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]benzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=Cc3c(F)c(F)c(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C18H13F5N4O/c1-3-27-8(2)25-11-6-9(4-5-12(11)27)18(28)26-24-7-10-13(19)15(21)17(23)16(22)14(10)20/h4-7H,3H2,1-2H3,(H,26,28) |
| InChIKey | JXXIAQILMMMTRA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|