C27H25N5O — CID 3882567
1-ethyl-2-methyl-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzimidazole-5-carboxamide (PubChem CID 3882567) has the molecular formula C27H25N5O and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzimidazole-5-carboxamide.
| Compound Name | 1-ethyl-2-methyl-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3882567 |
| Molecular Formula | C27H25N5O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-ethyl-2-methyl-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=Cc3c(-c4ccccc4)n(C)c4ccccc34)ccc21 |
| InChI | InChI=1S/C27H25N5O/c1-4-32-18(2)29-23-16-20(14-15-25(23)32)27(33)30-28-17-22-21-12-8-9-13-24(21)31(3)26(22)19-10-6-5-7-11-19/h5-17H,4H2,1-3H3,(H,30,33) |
| InChIKey | KCKQDQJBTDYYDG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|