C27H28N4O — CID 2443438
4-(diethylamino)-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzamide (PubChem CID 2443438) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-(diethylamino)-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 4-(diethylamino)-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2443438 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 4-(diethylamino)-N-[(1-methyl-2-phenylindol-3-yl)methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)NN=Cc2c(-c3ccccc3)n(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C27H28N4O/c1-4-31(5-2)22-17-15-21(16-18-22)27(32)29-28-19-24-23-13-9-10-14-25(23)30(3)26(24)20-11-7-6-8-12-20/h6-19H,4-5H2,1-3H3,(H,29,32) |
| InChIKey | VIAZQJDJLQVYTH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|