C18H16ClFN4O — CID 42991014
N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide (PubChem CID 42991014) has the molecular formula C18H16ClFN4O and a molecular weight of 358.80 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 42991014 |
| Molecular Formula | C18H16ClFN4O |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)N/N=C/c3c(F)cccc3Cl)ccc21 |
| InChI | InChI=1S/C18H16ClFN4O/c1-3-24-11(2)22-16-9-12(7-8-17(16)24)18(25)23-21-10-13-14(19)5-4-6-15(13)20/h4-10H,3H2,1-2H3,(H,23,25)/b21-10+ |
| InChIKey | PYVXKJUIGYMWKB-UFFVCSGVSA-N |
| XLogP | 3.92 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|