C22H14Cl2F2N4O2 — CID 3524205
1-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]benzene-1,4-dicarboxamide (PubChem CID 3524205) has the molecular formula C22H14Cl2F2N4O2 and a molecular weight of 475.28 g/mol. Its IUPAC name is 1-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 3524205 |
| Molecular Formula | C22H14Cl2F2N4O2 |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 1-N,4-N-bis[(2-chloro-6-fluorophenyl)methylideneamino]benzene-1,4-dicarboxamide |
| SMILES | O=C(NN=Cc1c(F)cccc1Cl)c1ccc(C(=O)NN=Cc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2F2N4O2/c23-17-3-1-5-19(25)15(17)11-27-29-21(31)13-7-9-14(10-8-13)22(32)30-28-12-16-18(24)4-2-6-20(16)26/h1-12H,(H,29,31)(H,30,32) |
| InChIKey | OHUOXQNRYMHINL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|