C9H8ClFN2O — CID 4166236
N-[(2-chloro-6-fluorophenyl)methylideneamino]acetamide (PubChem CID 4166236) has the molecular formula C9H8ClFN2O and a molecular weight of 214.63 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methylideneamino]acetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4166236 |
| Molecular Formula | C9H8ClFN2O |
| Molecular Weight | 214.63 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]acetamide |
| SMILES | CC(=O)NN=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C9H8ClFN2O/c1-6(14)13-12-5-7-8(10)3-2-4-9(7)11/h2-5H,1H3,(H,13,14) |
| InChIKey | XBNYAUVTIPBGMJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|