C17H13ClFN3O4 — CID 133240896
methyl 4-[[2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate (PubChem CID 133240896) has the molecular formula C17H13ClFN3O4 and a molecular weight of 377.76 g/mol. Its IUPAC name is methyl 4-[[2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 133240896 |
| Molecular Formula | C17H13ClFN3O4 |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | methyl 4-[[2-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C(=O)N/N=C\c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H13ClFN3O4/c1-26-17(25)10-5-7-11(8-6-10)21-15(23)16(24)22-20-9-12-13(18)3-2-4-14(12)19/h2-9H,1H3,(H,21,23)(H,22,24)/b20-9- |
| InChIKey | VCJALPDBHORJMK-UKWGHVSLSA-N |
| XLogP | 2.35 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|