C16H13Cl2N3O2S — CID 5499398
methyl 4-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamothioylamino]benzoate (PubChem CID 5499398) has the molecular formula C16H13Cl2N3O2S and a molecular weight of 382.27 g/mol. Its IUPAC name is methyl 4-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamothioylamino]benzoate.
| Compound Name | methyl 4-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 5499398 |
| Molecular Formula | C16H13Cl2N3O2S |
| Molecular Weight | 382.27 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | methyl 4-[[(Z)-(2,6-dichlorophenyl)methylideneamino]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N/N=C\c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2N3O2S/c1-23-15(22)10-5-7-11(8-6-10)20-16(24)21-19-9-12-13(17)3-2-4-14(12)18/h2-9H,1H3,(H2,20,21,24)/b19-9- |
| InChIKey | AXKNUNNJISQVCW-OCKHKDLRSA-N |
| XLogP | 4.10 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.27 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|