C9H9Cl2N3S — CID 6902921
1-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-methylthiourea (PubChem CID 6902921) has the molecular formula C9H9Cl2N3S and a molecular weight of 262.17 g/mol. Its IUPAC name is 1-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 6902921 |
| Molecular Formula | C9H9Cl2N3S |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 1-[(E)-(2,6-dichlorophenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H9Cl2N3S/c1-12-9(15)14-13-5-6-7(10)3-2-4-8(6)11/h2-5H,1H3,(H2,12,14,15)/b13-5+ |
| InChIKey | UGTYFAYAVJIFDU-WLRTZDKTSA-N |
| XLogP | 2.42 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|