C11H12Cl2N2O — CID 14593053
N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-methylpropanamide (PubChem CID 14593053) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-methylpropanamide.
| Compound Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 14593053 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | N-[(E)-(2,6-dichlorophenyl)methylideneamino]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c1-7(2)11(16)15-14-6-8-9(12)4-3-5-10(8)13/h3-7H,1-2H3,(H,15,16)/b14-6+ |
| InChIKey | GMQQCPGNVKFPRU-MKMNVTDBSA-N |
| XLogP | 3.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|