C16H14Cl2N2OS — CID 40529974
(2S)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 40529974) has the molecular formula C16H14Cl2N2OS and a molecular weight of 353.27 g/mol. Its IUPAC name is (2S)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 40529974 |
| Molecular Formula | C16H14Cl2N2OS |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (2S)-N-[(Z)-(2,6-dichlorophenyl)methylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | C[C@H](Sc1ccccc1)C(=O)N/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H14Cl2N2OS/c1-11(22-12-6-3-2-4-7-12)16(21)20-19-10-13-14(17)8-5-9-15(13)18/h2-11H,1H3,(H,20,21)/b19-10-/t11-/m0/s1 |
| InChIKey | LQBHBOMGYGQKKZ-ORPVNXHJSA-N |
| XLogP | 4.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|