C22H22ClN3OS — CID 94837974
(2S)-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 94837974) has the molecular formula C22H22ClN3OS and a molecular weight of 411.96 g/mol. Its IUPAC name is (2S)-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 94837974 |
| Molecular Formula | C22H22ClN3OS |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2S)-N-[(Z)-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@H](C)Sc2ccccc2)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3OS/c1-15-12-18(16(2)26(15)20-9-7-8-19(23)13-20)14-24-25-22(27)17(3)28-21-10-5-4-6-11-21/h4-14,17H,1-3H3,(H,25,27)/b24-14-/t17-/m0/s1 |
| InChIKey | QBZQHAQCFHCOEP-PDESAOGPSA-N |
| XLogP | 5.38 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|