C22H20Cl3N3OS — CID 92850888
(2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]propanamide (PubChem CID 92850888) has the molecular formula C22H20Cl3N3OS and a molecular weight of 480.85 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]propanamide.
| Compound Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]propanamide |
|---|---|
| PubChem CID | 92850888 |
| Molecular Formula | C22H20Cl3N3OS |
| Molecular Weight | 480.85 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)sulfanyl-N-[(Z)-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]propanamide |
| SMILES | Cc1cc(/C=N\NC(=O)[C@@H](C)Sc2ccc(Cl)cc2)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H20Cl3N3OS/c1-13-8-16(14(2)28(13)20-10-18(24)9-19(25)11-20)12-26-27-22(29)15(3)30-21-6-4-17(23)5-7-21/h4-12,15H,1-3H3,(H,27,29)/b26-12-/t15-/m1/s1 |
| InChIKey | DRLWFNOFXODJAO-RNSPVEPZSA-N |
| XLogP | 6.69 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.85 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|