C24H25BrClN3OS — CID 92663440
(2S)-N-[(Z)-[4-bromo-1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 92663440) has the molecular formula C24H25BrClN3OS and a molecular weight of 518.91 g/mol. Its IUPAC name is (2S)-N-[(Z)-[4-bromo-1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-[4-bromo-1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 92663440 |
| Molecular Formula | C24H25BrClN3OS |
| Molecular Weight | 518.91 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | (2S)-N-[(Z)-[4-bromo-1-(3,5-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(-n2c(C)c(Br)c(/C=N\NC(=O)[C@H](C)Sc3ccc(Cl)cc3)c2C)c1 |
| InChI | InChI=1S/C24H25BrClN3OS/c1-14-10-15(2)12-20(11-14)29-16(3)22(23(25)17(29)4)13-27-28-24(30)18(5)31-21-8-6-19(26)7-9-21/h6-13,18H,1-5H3,(H,28,30)/b27-13-/t18-/m0/s1 |
| InChIKey | XLCPYIVUILUEKH-JEBASELOSA-N |
| XLogP | 6.76 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.91 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|