C17H18ClNOS — CID 11836491
2-(4-chlorophenyl)sulfanyl-N-(3,5-dimethylphenyl)propanamide (PubChem CID 11836491) has the molecular formula C17H18ClNOS and a molecular weight of 319.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(3,5-dimethylphenyl)propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(3,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 11836491 |
| Molecular Formula | C17H18ClNOS |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(3,5-dimethylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(NC(=O)C(C)Sc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H18ClNOS/c1-11-8-12(2)10-15(9-11)19-17(20)13(3)21-16-6-4-14(18)5-7-16/h4-10,13H,1-3H3,(H,19,20) |
| InChIKey | UGTIJQWIYSZGPZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |