C17H19NO2S — CID 95048255
(2S)-N-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)sulfanylpropanamide (PubChem CID 95048255) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (2S)-N-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 95048255 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2S)-N-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)sulfanylpropanamide |
| SMILES | Cc1cc(C)cc(NC(=O)[C@H](C)Sc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H19NO2S/c1-11-8-12(2)10-14(9-11)18-17(20)13(3)21-16-6-4-15(19)5-7-16/h4-10,13,19H,1-3H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | ZBDVRXFJERRVOW-ZDUSSCGKSA-N |
| XLogP | 4.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |