C16H13Cl3N2O2S — CID 135614627
2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135614627) has the molecular formula C16H13Cl3N2O2S and a molecular weight of 403.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135614627 |
| Molecular Formula | C16H13Cl3N2O2S |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | CC(Sc1ccc(Cl)cc1)C(=O)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H13Cl3N2O2S/c1-9(24-13-4-2-11(17)3-5-13)16(23)21-20-8-10-6-12(18)7-14(19)15(10)22/h2-9,22H,1H3,(H,21,23)/b20-8+ |
| InChIKey | NQSBTNGCQXLZBE-DNTJNYDQSA-N |
| XLogP | 4.98 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|