C16H14Cl2N2O2S — CID 137077961
(2S)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 137077961) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is (2S)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 137077961 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | (2S)-N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | C[C@H](Sc1ccccc1)C(=O)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H14Cl2N2O2S/c1-10(23-13-5-3-2-4-6-13)16(22)20-19-9-11-7-12(17)8-14(18)15(11)21/h2-10,21H,1H3,(H,20,22)/b19-9-/t10-/m0/s1 |
| InChIKey | SBBBWARXNDOZPO-OVNPTBDBSA-N |
| XLogP | 4.33 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|