C14H10Cl2N2O2 — CID 773943
N-[(2,6-dichlorophenyl)methylideneamino]-4-hydroxybenzamide (PubChem CID 773943) has the molecular formula C14H10Cl2N2O2 and a molecular weight of 309.15 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 773943 |
| Molecular Formula | C14H10Cl2N2O2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methylideneamino]-4-hydroxybenzamide |
| SMILES | O=C(NN=Cc1c(Cl)cccc1Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H10Cl2N2O2/c15-12-2-1-3-13(16)11(12)8-17-18-14(20)9-4-6-10(19)7-5-9/h1-8,19H,(H,18,20) |
| InChIKey | JGOXYDQQKNUYBT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|